On Target PDE4B_HUMAN 0.36651585/CHEMBL36318
For the given ligand Icatibant, we have found in our database that, being scored 0.36651585, the most similar ligand is CHEMBL36318. Check out the elaboration below.
| Icatibant (Given Ligand) | CHEMBL36318 (Similar Ligand) |
|---|---|
| N=C(N)NCCC[C@@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N2C[C@H](O)C[C@H]2C(=O)NCC(=O)N[C@@H](Cc3cccs3)C(=O)N[C@@H](CO)C(=O)N5Cc4ccccc4C[C@@H]5C(=O)N7[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C[C@@H]6CCCC[C@@H]67 | COc1ccc(cc1OC2CCCC2)C3CCN(C3)C(=O)c4cccs4 |
|
|
|
|
|
|
| 00058008 01807200 00100100 14010e00 001800a0 00000010 01000080 2200300c 00200a80 004908c2 08300200 c003b080 1600b89a 01202003 82182480 121c4008 10000202 02000028 02c06008 00000205 80020900 783d8eb0 03004083 83500018 02402801 c6000005 40004000 90000204 0c000110 0086000b b80e4000 00c12e10 | 04010040 43001a08 22100108 00210700 00081000 c2000010 02040080 22005006 00000880 000808c0 08300200 40008080 0080c812 200000a0 11002401 020ca008 01811000 0200000c 00680000 00020209 00001100 58248680 01000000 9140001c 02000000 c4000000 00120000 90000004 04000300 0106000b a0000000 00c10640 |