On Target PDE4B_HUMAN 0.21/CHEMBL603830
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.21, the most similar ligand is CHEMBL603830. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL603830 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | CCCOc1cc(ccc1OC)[C@]2(C)CNC(=O)O2 |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 05000000 4a405008 20100308 00210600 00001080 8200c000 02040000 00000004 00400300 00080848 08200000 40008000 0080c002 20010080 01001005 0218a008 00020000 02000400 00080880 00020200 00000000 18200c30 03000000 81400018 00000000 80002002 10520000 00000000 04000200 0006000b c0000000 00000640 |