On Target ACM4_HUMAN 0.44155845/CHEMBL1223804
For the given ligand Alfentanil, we have found in our database that, being scored 0.44155845, the most similar ligand is CHEMBL1223804. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL1223804 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | CCO[C@@H]1CC[C@](C)(CC1)N2CCC(CC2)N3C(=O)Cc4ccc(C)cc34 |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 00004002 01001400 40100100 00010700 24180000 00000040 00000000 20000000 00000180 000809f0 08280004 50019800 01008002 00900000 40020140 0008100a 00848000 02000000 0a402000 00000201 60100420 18280610 21002000 81500019 00040400 80000200 00000210 10001080 04488200 00060013 00022000 20002e00 |