On Target BACE1_HUMAN 0.4172662/CHEMBL190644
For the given ligand Balsalazide, we have found in our database that, being scored 0.4172662, the most similar ligand is CHEMBL190644. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL190644 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | CCOCCCNC(=O)c1cc(NC(=O)Nc2cccc(Cl)c2)ccc1N(C)C |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 10008006 00001800 00100100 02010e40 04000000 08110000 08000000 02003001 00800000 00000850 00280004 40008800 02008806 08180001 00020440 10080008 00240000 03000002 08800000 00804200 40000120 18168700 21022080 0040001c 00142401 c0000000 00000000 80001080 20408300 00060001 a0040000 40024200 |