On Target BACE1_HUMAN 0.1923077/CHEMBL211256
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.1923077, the most similar ligand is CHEMBL211256. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL211256 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | CCOC(=O)CN1CCN(CC1)c2ccc(cc2NC(=O)c3cccc4ccccc34)c5ccccc5 |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 00006002 00000800 40000121 84010600 04000080 00000000 00000000 02201000 00000000 00000a50 00282004 4000e000 03008802 0010a001 00141048 00080008 10060000 02004000 0c000000 00000000 40100000 28028e08 32012020 02400006 00040400 80080080 00000220 800000c1 0840c300 02060001 80045000 00000200 |