On Target DRD2_HUMAN 0.4360465/CHEMBL2165134
For the given ligand Nefazodone, we have found in our database that, being scored 0.4360465, the most similar ligand is CHEMBL2165134. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL2165134 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | Clc1cccc(N2CCN(CCCCOc3ccc4cn[nH]c4c3)CC2)c1Cl |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 0400c002 00000008 20100028 05010700 001c1000 02000000 0e000000 28000000 00000000 00000ac0 00200004 40008800 02800006 00402001 11000041 000c200c 00040000 10000000 08600000 00264201 40100000 3c000108 21800821 02210012 00102000 00100400 00000200 10000080 08008200 00060000 00000000 02424a20 |