On Target NEP_HUMAN 0.35211268/CHEMBL3677665
For the given ligand Balsalazide, we have found in our database that, being scored 0.35211268, the most similar ligand is CHEMBL3677665. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL3677665 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | C[C@H](C[C@@H](Cc1ccc(cc1)c2ccccc2)NC(=O)c3cccc(c3)C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 00032000 01001800 00100102 00010600 00180001 00004000 10800000 22001004 00000980 00080cc0 48300000 40009800 0400880a 00a00000 00000400 08080008 00020000 02000000 04402000 50000201 00000100 18268e20 11000000 8140001c 00000000 c0000000 08000000 90000040 04004102 00060003 e0040000 00800e00 |