On Target HPGDS_HUMAN 0.41520467/CHEMBL3425956
For the given ligand Alfentanil, we have found in our database that, being scored 0.41520467, the most similar ligand is CHEMBL3425956. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL3425956 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | O=C(Cn1cnnn1)Nc2cncc(c2)c3cccc4[nH]ccc34 |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 00006002 00801818 40004120 00010630 04141000 0c000028 08000000 00000000 00000000 40000a50 00280004 6001a000 8100880c 00700000 40000e41 800c000c 00060000 c200080c 0ce00000 00040006 60160000 38028608 31802080 8040001c 00044003 80180000 08000640 000000c0 08404000 00460011 80040200 08000aa0 |