On Target NOS1_HUMAN 0.33333334/CHEMBL3216999
For the given ligand Nefazodone, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL3216999. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL3216999 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | Cl.Cl.CCOc1ccc(Cc2nc3cc(NC(=N)c4cccs4)ccc3n2CCN(CC)CC)cc1 |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 0401400a 00800418 22100508 50090600 001c1060 00084000 02048080 02001200 10200100 100818c3 0920920c 4081c080 00881812 01400020 01022cc1 020c008c 0004d000 03000009 08600000 0002020c c0121000 780480b0 21810001 02400410 0a000000 c4000002 40120080 80000084 0804831c 00460812 62080000 24c30ec0 |