On Target NOS1_HUMAN 0.24193548/CHEMBL1956111
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.24193548, the most similar ligand is CHEMBL1956111. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL1956111 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | CNC(=N)NCCC[C@H](N)C(=O)OC |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 00010000 01000000 00100000 00010d00 00080000 00000000 00000004 00002000 00200200 00000082 00200000 4003b000 04009010 01000000 00001000 00180008 00820000 00000000 00400000 00000001 00000100 10010a00 03000000 00100010 00010000 00000000 40000000 10000000 00000210 00040000 80080000 00000200 |