On Target OPRK_HUMAN 0.37356323/CHEMBL526747
For the given ligand Nefazodone, we have found in our database that, being scored 0.37356323, the most similar ligand is CHEMBL526747. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL526747 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | COc1cccc(c1)N2CCN(C(CN3CCCC3)C2)C(=O)CN(C)c4ccc(Cl)c(Cl)c4 |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 0000c002 80002408 20100028 05000600 20001000 00000010 0a000000 20000008 00000000 00000be0 00200004 4000a800 02008006 08002001 01020041 00000008 00040080 00000000 08000000 00026601 60100000 38000700 20000023 0200001a 00002000 00100080 00080000 10000080 08008200 00060011 00005000 02022200 |