On Target OPRK_HUMAN 0.24096386/CHEMBL3219944
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.24096386, the most similar ligand is CHEMBL3219944. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL3219944 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | COC(=O)[C@@H]1C[C@H](OC(=O)C)C(=O)[C@H]2[C@@]1(C)CC[C@H]3C(=O)O[C@@H](C[C@]23C)C(=O)N4CCCCC4 |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 00050040 01001000 00100300 80010700 80280080 00000000 00000000 20000000 00000000 00020080 00200000 5001d000 0400802a 00800000 00081008 08081008 10860000 80000100 12402000 00000201 00000020 10040e10 13000000 0010001c 10000400 00000000 00000000 10000001 00000200 00040003 00020000 02002200 |