On Target OPRK_HUMAN 0.5984252/CHEMBL609147
For the given ligand Alfentanil, we have found in our database that, being scored 0.5984252, the most similar ligand is CHEMBL609147. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL609147 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | CCC(=O)N(c1ccccc1)C2(COC)CCN(CCc3ccccc3)CC2 |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 00004002 01005400 00101100 00010700 20100080 00000000 00000000 20000000 00000080 000809e0 082c0004 50019000 00008002 00100000 000a1040 00080008 10040000 02000000 08400000 00000201 60100000 18280600 33002000 81500018 00000000 80000000 08800200 10000081 04008200 00060013 00000000 00002e00 |