On Target ALDR_HUMAN 0.3916084/CHEMBL414208
For the given ligand Balsalazide, we have found in our database that, being scored 0.3916084, the most similar ligand is CHEMBL414208. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL414208 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | CCOC(=O)C1=C(O)C(=O)N(Cc2ccc(OC)cc2)C1 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 00000008 00809008 20100108 10010600 00001080 08000000 02140000 02001c00 01000000 00000840 40200000 4000d000 88008802 00090000 01080401 00080008 30220800 02000101 20a50010 00020200 80002020 38108f00 03000080 00400018 00001401 c8008800 006a0200 80000400 00004300 00060001 2c040000 00000210 |