On Target ALDR_HUMAN 0.41904762/CHEMBL10382
For the given ligand Icatibant, we have found in our database that, being scored 0.41904762, the most similar ligand is CHEMBL10382. Check out the elaboration below.
| Icatibant (Given Ligand) | CHEMBL10382 (Similar Ligand) |
|---|---|
| N=C(N)NCCC[C@@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N2C[C@H](O)C[C@H]2C(=O)NCC(=O)N[C@@H](Cc3cccs3)C(=O)N[C@@H](CO)C(=O)N5Cc4ccccc4C[C@@H]5C(=O)N7[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C[C@@H]6CCCC[C@@H]67 | CN1C(=O)c2ccc(Cl)cc2C3(CC(=O)NC3=O)C1=O |
|
|
|
|
|
|
| 00058008 01807200 00100100 14010e00 001800a0 00000010 01000080 2200300c 00200a80 004908c2 08300200 c003b080 1600b89a 01202003 82182480 121c4008 10000202 02000028 02c06008 00000205 80020900 783d8eb0 03004083 83500018 02402801 c6000005 40004000 90000204 0c000110 0086000b b80e4000 00c12e10 | 00028008 04801e00 00900100 10010600 00000020 00008010 05000000 22001004 00200980 000809e0 08300000 40029800 0f0088c6 00200000 c0000480 02040000 00000210 02000021 00000018 00000201 80c20100 182e8740 00004000 814c001c 00003800 c0000101 00040000 90000000 04000102 0186001b a0042000 00820600 |