On Target AOFB_HUMAN 0.42063493/CHEMBL2426047
For the given ligand Balsalazide, we have found in our database that, being scored 0.42063493, the most similar ligand is CHEMBL2426047. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL2426047 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | CN(CCCOc1cccc(NC(=O)c2ccccc2)c1)CC#C |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 04004002 80000808 20100108 00010600 10403000 06000000 02000000 02101000 00000000 00000840 00280004 4000c000 00808802 08100000 01100041 00082008 00240080 02000000 08800000 00022600 40100000 18028600 21012080 00400014 00000001 80000000 00000000 80000080 00008300 00060001 80040020 00020240 |