On Target AOFB_HUMAN 0.34871796/CHEMBL4104691
For the given ligand Nefazodone, we have found in our database that, being scored 0.34871796, the most similar ligand is CHEMBL4104691. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL4104691 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | COCCn1ncc2cc(ccc12)C(=O)Nc3ccc(Cl)c(Cl)c3 |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 0000c006 00008c08 20000100 01010600 000c0000 00000000 0a000000 02001000 00000000 010008c0 0028000c 4001c800 02009806 00d00001 00201040 000c400c 00240000 02000004 08600000 00225200 40100000 1c078718 23812801 0e600004 00102000 80100000 00080200 80800090 00008300 00060041 80040000 02024220 |