On Target AOFB_HUMAN 0.18681319/CHEMBL3781329
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.18681319, the most similar ligand is CHEMBL3781329. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL3781329 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | Cl.N[C@@H]1C[C@H]1c2ccc(NC(=O)c3ccc(cc3)N4CCOCC4)cc2 |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 00004002 00000a00 00001100 c0010600 00000080 00000000 00000000 02001000 00000800 000808c0 083c0004 4000c000 00008802 01108000 00001048 00080108 10040000 02000000 08000000 00000001 40100100 18028600 32012000 81400014 00000400 80000000 08000000 80000080 04008300 0006000b 80040000 00020600 |