On Target ACM1_HUMAN 0.3846154/CHEMBL3746599
For the given ligand Balsalazide, we have found in our database that, being scored 0.3846154, the most similar ligand is CHEMBL3746599. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL3746599 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | O[C@H]1CCCC[C@@H]1NC(=O)c2cn(Cc3ccc(cc3)n4cccn4)c5ccccc25 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 1000000e 01805a08 20100100 80050610 000c1080 00004000 00004000 22001004 00100100 000108c0 01200004 40018000 80009822 00c00000 00000440 000c000c 10020008 82800000 02602000 00220201 c0000000 18078e38 23800800 8350001c 00044000 c0000000 08000000 90000000 04000100 00460009 e00c8200 800006a0 |