On Target ACM1_HUMAN 0.37704918/CHEMBL270580
For the given ligand Nefazodone, we have found in our database that, being scored 0.37704918, the most similar ligand is CHEMBL270580. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL270580 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | CCCCOc1cccc(c1)C(=O)Nc2ccc(N3CCN(CC)CC3)c(Cl)c2 |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 0400c002 44001808 20000128 05010700 00001000 02000000 0a000000 0a001000 00000000 00000a40 00280004 4000c800 02808806 00102081 11004041 20082008 00040000 12000000 08480000 00024201 40100000 28068700 21012020 02458016 00002000 80000400 00000000 80000080 08008300 00060001 80040000 00020200 |