On Target PGH1_SHEEP 0.42105263/CHEMBL151441
For the given ligand Balsalazide, we have found in our database that, being scored 0.42105263, the most similar ligand is CHEMBL151441. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL151441 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | COCCCNC(=O)c1ccccc1Nc2c(Cl)ccc(C)c2Cl |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 00008002 00001800 00100100 00010600 00000000 00110020 00000010 0a001040 00802000 00000851 00210004 40008800 02008806 00000400 00020440 00080008 00240000 03000002 08808002 00800200 41000000 18128700 21000080 0040001c 00042001 c0000600 02040000 80011080 00408308 00260001 a0040000 40020200 |