On Target PGH1_SHEEP 0.28735632/CHEMBL3331465
For the given ligand Nefazodone, we have found in our database that, being scored 0.28735632, the most similar ligand is CHEMBL3331465. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL3331465 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | CC(C)C1=C(COC(=O)Cc2ccccc2Nc3c(Cl)cccc3Cl)N(C)N(C1=O)c4ccccc4 |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 04008006 42002208 20080180 00010710 01080052 0000c422 00142012 08001040 06802304 800d88c1 09210004 6000b800 03808804 20610400 40060840 020e200c 08878801 83808000 0c480102 00620000 400104a0 78018b68 a1805800 83700014 00002400 c0000600 020a0028 80081880 0c00838d 1866100a c0062000 a60206a0 |