On Target PGH1_SHEEP 0.19587629/CHEMBL3809863
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.19587629, the most similar ligand is CHEMBL3809863. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL3809863 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | CC(C)C[C@H](NC(=O)CNC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C)C(=O)N[C@@H](C)C(=O)O |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 01010000 01407000 00100100 04010600 00000080 0001c000 00000000 20000008 00800300 000008c0 00200000 4001b000 0e008002 00012001 80180000 021a0008 10020000 02080400 00000890 00000201 00000000 38040e30 03000003 02500018 00000000 80002002 00000000 10200020 08000200 00060001 e0004000 00000200 |