On Target CNR1_HUMAN 0.41538462/CHEMBL3798331
For the given ligand Nefazodone, we have found in our database that, being scored 0.41538462, the most similar ligand is CHEMBL3798331. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL3798331 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | Cl.Clc1cccc(N2CCN(CCCCNC(=O)Oc3cccc4[nH]cnc34)CC2)c1Cl |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 0000c002 00001008 60100028 05000e00 00041040 0000c004 0e000000 28000008 04200300 00000ac0 01208004 40068800 02008006 08402001 01030045 001e000c 00060000 10082008 08200000 00064201 40100000 38040d70 31800021 0201201a 00002800 00110622 00004400 10000080 08008200 00460001 c0000000 30220280 |