On Target CNR1_HUMAN 0.47457626/CHEMBL562123
For the given ligand Icatibant, we have found in our database that, being scored 0.47457626, the most similar ligand is CHEMBL562123. Check out the elaboration below.
| Icatibant (Given Ligand) | CHEMBL562123 (Similar Ligand) |
|---|---|
| N=C(N)NCCC[C@@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N2C[C@H](O)C[C@H]2C(=O)NCC(=O)N[C@@H](Cc3cccs3)C(=O)N[C@@H](CO)C(=O)N5Cc4ccccc4C[C@@H]5C(=O)N7[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C[C@@H]6CCCC[C@@H]67 | CC(C)CN(CC(=O)N1CCc2sccc2C1c3ccc(F)cc3)C(=O)c4occc4 |
|
|
|
|
|
|
| 00058008 01807200 00100100 14010e00 001800a0 00000010 01000080 2200300c 00200a80 004908c2 08300200 c003b080 1600b89a 01202003 82182480 121c4008 10000202 02000028 02c06008 00000205 80020900 783d8eb0 03004083 83500018 02402801 c6000005 40004000 90000204 0c000110 0086000b b80e4000 00c12e10 | 10018088 00a03800 00180906 96010600 04100022 00000010 00000480 0320100d 02004180 004b0840 08200230 c080b080 4600ac9a 00203009 820034a0 10004000 00004201 820001a8 00104000 0010c205 80020800 78ac9e80 00004101 8348021c 0280e020 e4000000 04114010 c8000005 0e000180 00068003 b0044000 00c90e01 |