On Target NMDE2_HUMAN 0.35416666/CHEMBL2013199
For the given ligand Balsalazide, we have found in our database that, being scored 0.35416666, the most similar ligand is CHEMBL2013199. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL2013199 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | CCCNCc1c(O)ccc2[nH]c(nc12)c3ccccc3 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 10000002 00000808 20100100 10050610 00040060 00004000 06004000 02081400 00000100 10100850 41208004 40008000 00000806 00408000 00020440 020c200c 00020008 02002008 00200000 40460200 41000000 38008820 21800000 00400110 00046000 c0000000 00000040 80000000 00000104 00460c00 64048800 802402a0 |