On Target NMDE2_HUMAN 0.19565217/CHEMBL219060
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.19565217, the most similar ligand is CHEMBL219060. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL219060 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | O=C(OCc1ccccc1)N2CCC(CNc3ccncc3)CC2 |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 01000002 01401000 00104100 00010600 20040000 0000e000 00008000 20000000 00200300 000008c0 00200004 50038000 00008802 00010000 00020000 021e000c 00060000 02080400 00200880 00000201 40100000 18048c70 20800000 00500018 00000000 80002002 00008000 10200080 00000200 00060001 c0000000 00000240 |