On Target GRM5_HUMAN 0.34745762/CHEMBL3633955
For the given ligand Nefazodone, we have found in our database that, being scored 0.34745762, the most similar ligand is CHEMBL3633955. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL3633955 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | Clc1ccc(cc1)C(=O)N2CCCn3nc(COc4ccccc4)cc23 |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 04008007 00001c09 60120188 00010700 25181000 00008042 02800000 02003000 00a00300 100809d8 08380008 4001c800 02809866 00b50000 01230401 020c600c 01150801 07800000 00410000 80220200 a0100080 180b8750 a1814805 02d0901c 00042000 c0000000 22170000 800000c1 0102030c 10060011 e00c0400 00020a68 |