On Target GRM5_HUMAN 0.2/CHEMBL1290670
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.2, the most similar ligand is CHEMBL1290670. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL1290670 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | Fc1ccc(N2CCN(CC2)C(=O)COCc3ccccc3)c(F)c1 |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 00004002 00002800 00100320 86010600 01000090 00004010 00000000 00000008 00000100 00010a40 00201004 c000c000 00008002 00013000 00101048 02080008 10040400 82000000 08000000 00200000 40100000 28000620 72000020 0240000e 00000400 80002000 00080000 00000081 08008200 00068001 40000000 00000200 |