On Target P2RX3_HUMAN 0.38636363/CHEMBL2376118
For the given ligand Balsalazide, we have found in our database that, being scored 0.38636363, the most similar ligand is CHEMBL2376118. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL2376118 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | Cc1nc(\N=N\c2ccc(cc2)C(=O)O)c(CCC(=O)O)c(C=O)c1O |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 00000002 42005818 60004101 90890310 01045024 4002c004 03003000 00200004 00400b00 000c0850 00106104 40009800 84008804 08208800 00020050 1a0e200c 00018000 02880004 00600408 00220001 44400120 0c028e60 21824842 00682014 20053c01 81010021 880400d0 00000000 0050000d 00060002 c0000080 20000420 |