On Target AGTR2_HUMAN 0.3649635/CHEMBL376286
For the given ligand Balsalazide, we have found in our database that, being scored 0.3649635, the most similar ligand is CHEMBL376286. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL376286 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | CC[C@@H](C)[C@H](NC(=O)c1cccc(Cn2ccnc2)c1)C(=O)O |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 0001800a 01805a00 00100100 00010600 000810c1 00000000 10000000 22001000 00000100 00000cc0 00208008 4000b000 06009802 00000000 00000480 080c000c 10000000 02000000 00400800 00000201 80000000 18068e00 23000040 8140001c 00000000 c0000000 08000000 90000000 04000100 00460009 e00c4000 00000600 |