On Target AGTR2_HUMAN 0.3309859/CHEMBL125760
For the given ligand Nefazodone, we have found in our database that, being scored 0.3309859, the most similar ligand is CHEMBL125760. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL125760 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | CCOCC(=O)Nc1ccc(Cl)c(c1)N2N=C(CC)N(Cc3ccc(cc3F)c4ccccc4S(=O)(=O)NC(=O)OC(C)(C)C)C2=O |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 0000e016 00c00809 41181100 86f18700 090000d0 0a00c434 00808802 00821200 8640010c 10042860 002ca10d 7200d800 8209880c 04591001 98361048 011a200c 0a06a280 82004000 0cc80000 90256000 c0140080 18008f30 33202040 8968241c 0008a444 c010c682 c8088400 000500cf 0482c705 20468041 c0265080 220303e0 |