On Target AGTR2_HUMAN 0.345/CHEMBL348157
For the given ligand Alfentanil, we have found in our database that, being scored 0.345, the most similar ligand is CHEMBL348157. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL348157 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | CCCCCN(Cc1ccc(cc1)c2ccccc2c3nn[nH]n3)C(=O)N4CCN([C@@H](C4)C(=O)O)C(=O)N(c5ccccc5)c6ccccc6 |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 00012016 01807019 40100100 04010e00 00000080 08020008 00000014 22083009 00002100 000208c0 01288004 4001b000 8e00b882 00302001 20100440 0008200c 30064010 02400801 0c800052 10000201 c0060100 38158e00 3302a0a1 02504018 00113003 c0200000 12000000 900000c0 0800c104 00060001 a00c4200 88004200 |