On Target OPRM_MOUSE 0.5775401/CHEMBL330991
For the given ligand Icatibant, we have found in our database that, being scored 0.5775401, the most similar ligand is CHEMBL330991. Check out the elaboration below.
| Icatibant (Given Ligand) | CHEMBL330991 (Similar Ligand) |
|---|---|
| N=C(N)NCCC[C@@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N2C[C@H](O)C[C@H]2C(=O)NCC(=O)N[C@@H](Cc3cccs3)C(=O)N[C@@H](CO)C(=O)N5Cc4ccccc4C[C@@H]5C(=O)N7[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C[C@@H]6CCCC[C@@H]67 | CC(C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H]1Cc2ccccc2CN1C(=O)[C@@H](C)NC(=O)[C@@H](N)Cc3ccc(O)cc3)C(C)C)C(=O)NCC(=O)N |
|
|
|
|
|
|
| 00058008 01807200 00100100 14010e00 001800a0 00000010 01000080 2200300c 00200a80 004908c2 08300200 c003b080 1600b89a 01202003 82182480 121c4008 10000202 02000028 02c06008 00000205 80020900 783d8eb0 03004083 83500018 02402801 c6000005 40004000 90000204 0c000110 0086000b b80e4000 00c12e10 | 00068008 00803208 20100100 14010600 00100020 00000000 03000000 2200100c 00000880 000908c0 08300000 4000b000 0e008882 00202001 80000480 020c0008 00000200 02000021 00c00018 00020201 80020100 38308e00 01004083 83400018 00001801 c0000001 00124000 90000000 0c000102 0086000b 20044000 00802e00 |