On Target OPRM_MOUSE 0.17757009/CHEMBL2311157
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.17757009, the most similar ligand is CHEMBL2311157. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL2311157 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | [11CH3]OC(=O)C1(CCN(CCc2ccccc2)CC1)N(C(=O)CC)c3ccccc3 |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 00024002 01005400 00101100 00010700 20100080 00000000 00000000 20000000 00000080 000809e0 082c0004 5001b000 06008002 00100000 800a1040 00080008 10060000 02000000 08400000 00000201 60100000 18280e00 33002000 81500018 00000000 80000080 08800200 10000081 04008200 00060013 20005000 00802e00 |