On Target P2Y12_HUMAN 0.2988048/CHEMBL3325894
For the given ligand Nefazodone, we have found in our database that, being scored 0.2988048, the most similar ligand is CHEMBL3325894. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL3325894 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | CCCC(=O)c1cnn(C2CCN(CC2)NC(=O)c3cn(CC(=O)N4CCN(C)CC4)c5ccc(Cl)cc35)c1C |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 00008006 4b803c08 20180186 44810618 011c1100 40008102 00046000 0000100c 02200800 000809c8 0130000c 5001b800 0600984e 20e42000 200008e0 0c0c200c 00100008 c2800000 04680000 00220a01 c0000000 38079718 61804823 8250001e 08056000 c0000001 08060004 10000000 09000404 004e0013 800d0200 80061ae8 |