On Target NOS2_HUMAN 0.27868852/CHEMBL473674
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.27868852, the most similar ligand is CHEMBL473674. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL473674 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | Br.CCOC(=O)N1CCC(CC1)NC(=N)C |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 00000000 01401400 00100000 00000600 00000000 00008000 00000000 00000000 00000200 000001a3 00200000 50018000 00008002 00000000 00000000 001a0008 00020000 00080000 00000800 00000201 00000000 100c0cd0 00000000 00100018 00000000 00000002 40000000 10200000 00000210 00040011 80000008 00000200 |