On Target SCN9A_HUMAN 0.41843972/CHEMBL3944511
For the given ligand Balsalazide, we have found in our database that, being scored 0.41843972, the most similar ligand is CHEMBL3944511. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL3944511 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | CNC(=O)c1cccc(Nc2ncnc(n2)N3CCC(CC3)Oc4ccccc4)c1 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 14010002 01000809 20100108 00010600 02001000 0a000000 02000000 02101880 00800100 000008d0 00200004 50039800 04808802 00000000 01000041 1008200c 00241000 12004000 08800008 10220201 40080000 18028600 61004080 00500014 00040001 80000000 00000000 900000c0 20408308 00460001 c0041000 00000240 |