On Target SCN9A_HUMAN 0.34188035/CHEMBL251346
For the given ligand Nefazodone, we have found in our database that, being scored 0.34188035, the most similar ligand is CHEMBL251346. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL251346 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | CC(C)N1C(=O)[C@@H](CCc2cc(Cl)ccc12)NC(=O)[C@@H](Cc3ccccc3OC(F)(F)F)NC(=O)OC(C)(C)C |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 0001c002 05403208 2010012a 04010600 20001010 0001a040 07000000 2000020c 00d00a00 08080ac0 08380024 4841b8c0 0e008006 00302001 81020041 001e200a 90268000 02080000 08000818 00020201 40100100 38240f10 2000200b 8354041a 00002840 c0000002 00080010 d02010a0 0e088300 0006800b a0004080 22422600 |