On Target PRGR_HUMAN 0.33526012/CHEMBL194812
For the given ligand Balsalazide, we have found in our database that, being scored 0.33526012, the most similar ligand is CHEMBL194812. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL194812 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | COc1ccc(F)cc1C(C)(C)CC(O)(C(=O)Nc2ccc3C(=O)OCc3c2)C(F)(F)F |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 00014002 01000808 6010110a 82090600 24001090 0800e010 02000000 00000200 00100900 000828d0 08380004 5001d840 04008002 00319000 01020041 02082408 00060000 02000200 08410000 80420001 40100100 18020f20 23003040 20580414 00040400 c0002000 88080060 90000081 00528300 0207c003 c0000000 00400600 |