On Target PRGR_HUMAN 0.38020834/CHEMBL552108
For the given ligand Nefazodone, we have found in our database that, being scored 0.38020834, the most similar ligand is CHEMBL552108. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL552108 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | CC(N(CC1CCCCC1)c2ccc(C#N)c(Cl)c2)c3nncn3C |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 0000c002 01200808 40100100 01010e00 21020020 00102004 08800000 28002601 00000900 009408c0 00218124 47018800 02000006 00008009 00020040 0008200c 00448000 02400002 0ac02000 00264201 40100001 18010110 21000400 00500410 00002000 c0000601 00000000 10030080 00008004 00060400 84020080 20020200 |