On Target PRGR_HUMAN 0.17307693/CHEMBL500938
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.17307693, the most similar ligand is CHEMBL500938. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL500938 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | CCCNC(=O)O[C@@]1([C@@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]12C)C(=O)CO |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 00010002 81401000 00100100 00091700 00281480 00008000 00000080 82000402 01000200 01100000 00200000 4000d000 04028028 00800100 00000400 001a0008 00820000 80080000 13412800 00022001 00000001 10000e90 01008000 00520818 00200000 00001002 00404020 90200000 00000200 0304000b a4020000 02000200 |