On Target AA2AR_HUMAN 0.41549295/CHEMBL194860
For the given ligand Balsalazide, we have found in our database that, being scored 0.41549295, the most similar ligand is CHEMBL194860. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL194860 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | CC(C)CCNC(=O)c1cnc2nc(C)ccc2c1O |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 10000002 01809808 20104100 10010610 00041020 00024000 04004000 22001400 00000100 001000c0 41200004 40008800 00008802 00d00000 00020440 020c200c 00020000 0200000c 00200000 40060201 c0000000 18068e28 20800000 8040011c 00040000 c0000000 08000040 90000000 00400104 00460001 e4040000 80240280 |