On Target CXCR1_HUMAN 0.36756757/CHEMBL556656
For the given ligand Balsalazide, we have found in our database that, being scored 0.36756757, the most similar ligand is CHEMBL556656. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL556656 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | CC[C@@H](NC1=C(Nc2cccc(C(=O)N3CC[C@H](O)C3)c2O)C(=O)C1=O)c4ccccc4 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 1040c00a 00005808 60100102 00012600 20010081 68022010 020000a0 22401500 05a00c40 001808d0 08380004 5042b000 0a008802 00200000 80020440 10086048 10050001 22008000 08a30210 20020201 48100980 18168600 23000080 0040801c 04041001 c0000080 20400010 900c0580 20508102 20060003 a4045420 40002600 |