On Target CXCR1_HUMAN 0.24017467/CHEMBL376621
For the given ligand Nefazodone, we have found in our database that, being scored 0.24017467, the most similar ligand is CHEMBL376621. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL376621 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | CN(C)S(=O)(=O)c1c(Cl)ccc(N\C(=N\C#N)\Nc2ccccc2OCc3ccccc3)c1O |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 04008016 00800018 21000108 00b10a40 80001200 00024000 12000000 01002001 00040100 00004842 10242004 60008840 02804006 0001000b 81200151 0208c208 00842a00 0a000000 08400000 00026300 d0020102 08002120 20420400 08c31008 0090a800 80082000 60080808 0000008c 00008690 20060004 40000000 06034068 |