On Target CXCR1_HUMAN 0.11764706/CHEMBL139
For the given ligand Carbamoylcholine, we have found in our database that, being scored 0.11764706, the most similar ligand is CHEMBL139. Check out the elaboration below.
| Carbamoylcholine (Given Ligand) | CHEMBL139 (Similar Ligand) |
|---|---|
| C[N+](C)(C)CCOC(N)=O | OC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl |
|
|
|
|
|
|
| 00000000 00400000 00000200 00000600 00000080 00000000 00000000 00000000 00000000 00000000 00200000 40008000 00008000 00000200 00001000 00180008 00060000 00000000 00000000 00000000 00000000 00000c00 12000000 00000000 00000000 00080002 00000000 00000000 00000200 00040000 00000000 00000200 | 00008002 00000000 00000100 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 40009800 03008004 00000400 40060040 00080008 08048000 02000000 08000002 00000000 40000400 48000b00 21000000 00400010 00002000 80000600 02000008 00001080 00008008 00261002 00002000 20020400 |