On Target DRD4_HUMAN 0.4051724/CHEMBL1771111
For the given ligand Icatibant, we have found in our database that, being scored 0.4051724, the most similar ligand is CHEMBL1771111. Check out the elaboration below.
| Icatibant (Given Ligand) | CHEMBL1771111 (Similar Ligand) |
|---|---|
| N=C(N)NCCC[C@@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N2C[C@H](O)C[C@H]2C(=O)NCC(=O)N[C@@H](Cc3cccs3)C(=O)N[C@@H](CO)C(=O)N5Cc4ccccc4C[C@@H]5C(=O)N7[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C[C@@H]6CCCC[C@@H]67 | COc1ccccc1N2CCN(CCCCN3CCCc4cc(ccc4C3=O)c5cccs5)CC2 |
|
|
|
|
|
|
| 00058008 01807200 00100100 14010e00 001800a0 00000010 01000080 2200300c 00200a80 004908c2 08300200 c003b080 1600b89a 01202003 82182480 121c4008 10000202 02000028 02c06008 00000205 80020900 783d8eb0 03004083 83500018 02402801 c6000005 40004000 90000204 0c000110 0086000b b80e4000 00c12e10 | 0001600a 00001a08 20100128 54010e00 80001001 00008000 02040080 2a101008 00200900 00080ac1 08310204 40028280 80008892 00202000 01002441 020c4008 00060000 02001008 0c000000 10020201 40520110 780686c0 31004021 0240801e 02000080 c4000081 20004000 900002c5 0800c308 0086000b a0040800 00c12600 |