On Target PGH2_HUMAN 0.3828125/CHEMBL122065
For the given ligand Balsalazide, we have found in our database that, being scored 0.3828125, the most similar ligand is CHEMBL122065. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL122065 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | CCCNC(=O)c1cc(c2OCC(C)(C)c2c1)C(C)(C)C |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 04001000 00001808 20100109 00010600 00001041 82000000 12040000 02001240 00000000 00080a40 08200000 40008000 00808802 00000000 01040401 08082018 08000000 22008000 04000400 00020200 00000000 18028600 01000000 0040001c 00000000 c0000000 08220000 80800004 00000300 00060003 a0040000 00000600 |