On Target TRY1_HUMAN 0.5445545/CHEMBL134268
For the given ligand Balsalazide, we have found in our database that, being scored 0.5445545, the most similar ligand is CHEMBL134268. Check out the elaboration below.
| Balsalazide (Given Ligand) | CHEMBL134268 (Similar Ligand) |
|---|---|
| O=C(O)CCNC(=O)c2ccc(/N=N/c1ccc(O)c(C(=O)O)c1)cc2 | CC(C)(CNC(=O)c1ccccc1)C(=O)OC(=O)C(C)(C)CNC(=O)c2ccccc2 |
|
|
|
|
|
|
| 00000002 00001808 60100100 80010600 00004000 00024000 02000000 02001800 00000300 00040840 00200104 40009000 08008802 08000000 00000450 10082008 00008000 02800001 00800010 80020200 40000000 18128e20 21000082 0040201c 00051401 c1000000 80040000 80000000 00500100 00060001 e0040080 00000200 | 00800040 00001800 00100100 00010600 00000000 00000000 00000000 02001000 00000000 00000840 00200000 40009000 08008802 00080000 00000400 00080008 00220000 02000001 00800010 00000200 00000020 18128e00 01000080 0040001c 00001401 c0000000 00000000 80000000 00000300 00060005 a0040000 00000200 |