On Target TRY1_HUMAN 0.3515625/CHEMBL2373348
For the given ligand Nefazodone, we have found in our database that, being scored 0.3515625, the most similar ligand is CHEMBL2373348. Check out the elaboration below.
| Nefazodone (Given Ligand) | CHEMBL2373348 (Similar Ligand) |
|---|---|
| CCc3nn(CCCN2CCN(c1cccc(Cl)c1)CC2)c(=O)n3CCOc4ccccc4 | CC1(C)[C@@H]2C[C@H]3OB(O[C@@]3(C)[C@H]1C2)[C@H](CCCCN)NC(=O)Cn4nc(nc4Cc5ccccc5)c6cccc(N)c6 |
|
|
|
|
|
|
| 0400c006 00000409 60100028 05010742 01181010 80008484 0a800800 00000200 04200102 90060be0 0020890c 42008800 02808006 01402001 010210c1 000ab00c 00b48000 00080000 18400000 00264200 c0100000 38240150 23000021 06600412 00002040 c0000200 40000000 000100a0 09008305 00060010 80200080 20020b48 | 00008006 01801e08 c0101108 00051ec0 01180000 0008c004 90c00200 24083340 00010700 100e08c1 0825900c 6201a810 02888003 00800091 00034c40 2018204c 0000c000 c6022001 0ac03000 00a20201 c0100001 3846a6e8 25000081 07564c1c 00040011 c0000200 54000018 100110a0 09448115 00261013 a2020a80 20000f2a |